C11H11ClF3NO3 — CID 61490517
2-(2,2,2-trifluoroethoxy)ethyl 3-amino-4-chlorobenzoate (PubChem CID 61490517) has the molecular formula C11H11ClF3NO3 and a molecular weight of 297.66 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)ethyl 3-amino-4-chlorobenzoate.
| Compound Name | 2-(2,2,2-trifluoroethoxy)ethyl 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 61490517 |
| Molecular Formula | C11H11ClF3NO3 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)ethyl 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCCOCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H11ClF3NO3/c12-8-2-1-7(5-9(8)16)10(17)19-4-3-18-6-11(13,14)15/h1-2,5H,3-4,6,16H2 |
| InChIKey | WAYCBUMEMIEQPU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|