C13H18N2O3S — CID 107325487
2,3-dihydroxy-N-(2-thiomorpholin-4-ylethyl)benzamide (PubChem CID 107325487) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-thiomorpholin-4-ylethyl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(2-thiomorpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 107325487 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,3-dihydroxy-N-(2-thiomorpholin-4-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCSCC1)c1cccc(O)c1O |
| InChI | InChI=1S/C13H18N2O3S/c16-11-3-1-2-10(12(11)17)13(18)14-4-5-15-6-8-19-9-7-15/h1-3,16-17H,4-9H2,(H,14,18) |
| InChIKey | NSODIMIVIFDJAE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|