C12H15ClN4OS — CID 114131593
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[2-(4-methylpyrazol-1-yl)ethyl]acetamide (PubChem CID 114131593) has the molecular formula C12H15ClN4OS and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[2-(4-methylpyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[2-(4-methylpyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 114131593 |
| Molecular Formula | C12H15ClN4OS |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[2-(4-methylpyrazol-1-yl)ethyl]acetamide |
| SMILES | Cc1cnn(CCNC(=O)Cc2nc(CCl)cs2)c1 |
| InChI | InChI=1S/C12H15ClN4OS/c1-9-6-15-17(7-9)3-2-14-11(18)4-12-16-10(5-13)8-19-12/h6-8H,2-5H2,1H3,(H,14,18) |
| InChIKey | WTCDWLJKMYIFEE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|