C10H11ClN4O2S — CID 114184685
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]acetamide (PubChem CID 114184685) has the molecular formula C10H11ClN4O2S and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 114184685 |
| Molecular Formula | C10H11ClN4O2S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]acetamide |
| SMILES | Cc1nc(CNC(=O)Cc2nc(CCl)cs2)no1 |
| InChI | InChI=1S/C10H11ClN4O2S/c1-6-13-8(15-17-6)4-12-9(16)2-10-14-7(3-11)5-18-10/h5H,2-4H2,1H3,(H,12,16) |
| InChIKey | LOTOEDPTOGKSPV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|