C10H16ClN3O2S2 — CID 62994658
4-(chloromethyl)-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 62994658) has the molecular formula C10H16ClN3O2S2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62994658 |
| Molecular Formula | C10H16ClN3O2S2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-(chloromethyl)-2-[(4-methylsulfonylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CCN(Cc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C10H16ClN3O2S2/c1-18(15,16)14-4-2-13(3-5-14)7-10-12-9(6-11)8-17-10/h8H,2-7H2,1H3 |
| InChIKey | JBNNHYVRFAHWDZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|