C11H17ClN2O2S3 — CID 66378095
4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-ethylsulfonylthiomorpholine (PubChem CID 66378095) has the molecular formula C11H17ClN2O2S3 and a molecular weight of 340.92 g/mol. Its IUPAC name is 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-ethylsulfonylthiomorpholine.
| Compound Name | 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-ethylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66378095 |
| Molecular Formula | C11H17ClN2O2S3 |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-ethylsulfonylthiomorpholine |
| SMILES | CCS(=O)(=O)C1CSCCN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H17ClN2O2S3/c1-2-19(15,16)11-8-17-4-3-14(11)6-10-13-9(5-12)7-18-10/h7,11H,2-6,8H2,1H3 |
| InChIKey | MQHKMLCWIPBGQB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|