C15H24N2O2S2 — CID 66377959
2-[4-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]phenyl]ethanamine (PubChem CID 66377959) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-[4-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]phenyl]ethanamine.
| Compound Name | 2-[4-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]phenyl]ethanamine |
|---|---|
| PubChem CID | 66377959 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[4-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]phenyl]ethanamine |
| SMILES | CCS(=O)(=O)C1CSCCN1Cc1ccc(CCN)cc1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-2-21(18,19)15-12-20-10-9-17(15)11-14-5-3-13(4-6-14)7-8-16/h3-6,15H,2,7-12,16H2,1H3 |
| InChIKey | ZMPIPFNAOWIXPZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |