C17H21N3OS — CID 97160299
2-[(3S)-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-3-yl]acetamide (PubChem CID 97160299) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[(3S)-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 97160299 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[(3S)-1-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCN(Cc2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C17H21N3OS/c18-16(21)9-13-5-4-8-20(10-13)11-17-19-15(12-22-17)14-6-2-1-3-7-14/h1-3,6-7,12-13H,4-5,8-11H2,(H2,18,21)/t13-/m0/s1 |
| InChIKey | ZAFGAGQHLCTQJM-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |