C18H21FN4O5S — CID 71780540
2-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetamide;oxalic acid (PubChem CID 71780540) has the molecular formula C18H21FN4O5S and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetamide;oxalic acid.
| Compound Name | 2-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71780540 |
| Molecular Formula | C18H21FN4O5S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-[4-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetamide;oxalic acid |
| SMILES | NC(=O)CN1CCN(Cc2nc(-c3ccc(F)cc3)cs2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H19FN4OS.C2H2O4/c17-13-3-1-12(2-4-13)14-11-23-16(19-14)10-21-7-5-20(6-8-21)9-15(18)22;3-1(4)2(5)6/h1-4,11H,5-10H2,(H2,18,22);(H,3,4)(H,5,6) |
| InChIKey | SCTHFZDXMBNAAJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|