C26H28N4O6S — CID 71780538
N-(4-acetylphenyl)-2-[4-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid (PubChem CID 71780538) has the molecular formula C26H28N4O6S and a molecular weight of 524.60 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[4-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid.
| Compound Name | N-(4-acetylphenyl)-2-[4-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71780538 |
| Molecular Formula | C26H28N4O6S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | N-(4-acetylphenyl)-2-[4-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]acetamide;oxalic acid |
| SMILES | CC(=O)c1ccc(NC(=O)CN2CCN(Cc3nc(-c4ccccc4)cs3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H26N4O2S.C2H2O4/c1-18(29)19-7-9-21(10-8-19)25-23(30)15-27-11-13-28(14-12-27)16-24-26-22(17-31-24)20-5-3-2-4-6-20;3-1(4)2(5)6/h2-10,17H,11-16H2,1H3,(H,25,30);(H,3,4)(H,5,6) |
| InChIKey | XRAUVRNSVPZUHP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|