C24H26N4O8S — CID 71780572
methyl 4-[[2-[4-[[4-(furan-2-yl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetyl]amino]benzoate;oxalic acid (PubChem CID 71780572) has the molecular formula C24H26N4O8S and a molecular weight of 530.56 g/mol. Its IUPAC name is methyl 4-[[2-[4-[[4-(furan-2-yl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetyl]amino]benzoate;oxalic acid.
| Compound Name | methyl 4-[[2-[4-[[4-(furan-2-yl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetyl]amino]benzoate;oxalic acid |
|---|---|
| PubChem CID | 71780572 |
| Molecular Formula | C24H26N4O8S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | methyl 4-[[2-[4-[[4-(furan-2-yl)-1,3-thiazol-2-yl]methyl]piperazin-1-yl]acetyl]amino]benzoate;oxalic acid |
| SMILES | COC(=O)c1ccc(NC(=O)CN2CCN(Cc3nc(-c4ccco4)cs3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H24N4O4S.C2H2O4/c1-29-22(28)16-4-6-17(7-5-16)23-20(27)13-25-8-10-26(11-9-25)14-21-24-18(15-31-21)19-3-2-12-30-19;3-1(4)2(5)6/h2-7,12,15H,8-11,13-14H2,1H3,(H,23,27);(H,3,4)(H,5,6) |
| InChIKey | XVZWFZDLVXLCTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|