C7H10ClN3O2S2 — CID 130752083
2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 130752083) has the molecular formula C7H10ClN3O2S2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 130752083 |
| Molecular Formula | C7H10ClN3O2S2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)NCCN1Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C7H10ClN3O2S2/c8-3-6-5-14-7(10-6)4-11-2-1-9-15(11,12)13/h5,9H,1-4H2 |
| InChIKey | YSKCRXHURWQFKN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|