C11H12ClN3OS — CID 80581451
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-cyclopropylimidazol-2-one (PubChem CID 80581451) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-cyclopropylimidazol-2-one.
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-cyclopropylimidazol-2-one |
|---|---|
| PubChem CID | 80581451 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-cyclopropylimidazol-2-one |
| SMILES | O=c1n(Cc2nc(CCl)cs2)ccn1C1CC1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-5-8-7-17-10(13-8)6-14-3-4-15(11(14)16)9-1-2-9/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | BNXFDGCLTXTOPV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|