C11H14ClN3OS — CID 80581389
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylimidazol-2-one (PubChem CID 80581389) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylimidazol-2-one.
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylimidazol-2-one |
|---|---|
| PubChem CID | 80581389 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylimidazol-2-one |
| SMILES | CC(C)n1ccn(Cc2nc(CCl)cs2)c1=O |
| InChI | InChI=1S/C11H14ClN3OS/c1-8(2)15-4-3-14(11(15)16)6-10-13-9(5-12)7-17-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | QYCKMHNEIATOIV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|