C14H15ClN2O2S2 — CID 43620082
2-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 43620082) has the molecular formula C14H15ClN2O2S2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 43620082 |
| Molecular Formula | C14H15ClN2O2S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-[[2-[4-(chloromethyl)-1,3-thiazol-2-yl]phenyl]methyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1Cc1ccccc1-c1nc(CCl)cs1 |
| InChI | InChI=1S/C14H15ClN2O2S2/c15-8-12-10-20-14(16-12)13-5-2-1-4-11(13)9-17-6-3-7-21(17,18)19/h1-2,4-5,10H,3,6-9H2 |
| InChIKey | TUXSDLYKKSIYAV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|