C17H21ClN2S — CID 43138294
4-(chloromethyl)-2-[2-[(2-methylpiperidin-1-yl)methyl]phenyl]-1,3-thiazole (PubChem CID 43138294) has the molecular formula C17H21ClN2S and a molecular weight of 320.89 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-[(2-methylpiperidin-1-yl)methyl]phenyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-[(2-methylpiperidin-1-yl)methyl]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43138294 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-(chloromethyl)-2-[2-[(2-methylpiperidin-1-yl)methyl]phenyl]-1,3-thiazole |
| SMILES | CC1CCCCN1Cc1ccccc1-c1nc(CCl)cs1 |
| InChI | InChI=1S/C17H21ClN2S/c1-13-6-4-5-9-20(13)11-14-7-2-3-8-16(14)17-19-15(10-18)12-21-17/h2-3,7-8,12-13H,4-6,9-11H2,1H3 |
| InChIKey | WHMNTBKDVYSJDG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|