C14H11BrClN3S — CID 61034902
2-[2-[(4-bromopyrazol-1-yl)methyl]phenyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 61034902) has the molecular formula C14H11BrClN3S and a molecular weight of 368.69 g/mol. Its IUPAC name is 2-[2-[(4-bromopyrazol-1-yl)methyl]phenyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[2-[(4-bromopyrazol-1-yl)methyl]phenyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 61034902 |
| Molecular Formula | C14H11BrClN3S |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2-[2-[(4-bromopyrazol-1-yl)methyl]phenyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2ccccc2Cn2cc(Br)cn2)n1 |
| InChI | InChI=1S/C14H11BrClN3S/c15-11-6-17-19(8-11)7-10-3-1-2-4-13(10)14-18-12(5-16)9-20-14/h1-4,6,8-9H,5,7H2 |
| InChIKey | MJLVDSDOLQZYPE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|