C14H12ClN3S — CID 43138436
4-(chloromethyl)-2-[2-(pyrazol-1-ylmethyl)phenyl]-1,3-thiazole (PubChem CID 43138436) has the molecular formula C14H12ClN3S and a molecular weight of 289.79 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-(pyrazol-1-ylmethyl)phenyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-(pyrazol-1-ylmethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43138436 |
| Molecular Formula | C14H12ClN3S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4-(chloromethyl)-2-[2-(pyrazol-1-ylmethyl)phenyl]-1,3-thiazole |
| SMILES | ClCc1csc(-c2ccccc2Cn2cccn2)n1 |
| InChI | InChI=1S/C14H12ClN3S/c15-8-12-10-19-14(17-12)13-5-2-1-4-11(13)9-18-7-3-6-16-18/h1-7,10H,8-9H2 |
| InChIKey | VODURSACAASOBZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|