C16H14ClNO2S — CID 43320209
4-(chloromethyl)-2-[2-(furan-2-ylmethoxymethyl)phenyl]-1,3-thiazole (PubChem CID 43320209) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-(furan-2-ylmethoxymethyl)phenyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-(furan-2-ylmethoxymethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43320209 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-(chloromethyl)-2-[2-(furan-2-ylmethoxymethyl)phenyl]-1,3-thiazole |
| SMILES | ClCc1csc(-c2ccccc2COCc2ccco2)n1 |
| InChI | InChI=1S/C16H14ClNO2S/c17-8-13-11-21-16(18-13)15-6-2-1-4-12(15)9-19-10-14-5-3-7-20-14/h1-7,11H,8-10H2 |
| InChIKey | XEWJTVGXUHWWDD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|