C8H5BrClNS2 — CID 130157549
2-(4-bromothiophen-3-yl)-4-(chloromethyl)-1,3-thiazole (PubChem CID 130157549) has the molecular formula C8H5BrClNS2 and a molecular weight of 294.63 g/mol. Its IUPAC name is 2-(4-bromothiophen-3-yl)-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(4-bromothiophen-3-yl)-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130157549 |
| Molecular Formula | C8H5BrClNS2 |
| Molecular Weight | 294.63 g/mol |
| Exact Mass | 292.87 |
| IUPAC Name | 2-(4-bromothiophen-3-yl)-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2cscc2Br)n1 |
| InChI | InChI=1S/C8H5BrClNS2/c9-7-4-12-3-6(7)8-11-5(1-10)2-13-8/h2-4H,1H2 |
| InChIKey | VYFMTIRLRRCTMC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|