C8H4BrCl2NS2 — CID 102842144
2-(4-bromo-5-chlorothiophen-2-yl)-4-(chloromethyl)-1,3-thiazole (PubChem CID 102842144) has the molecular formula C8H4BrCl2NS2 and a molecular weight of 329.07 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 102842144 |
| Molecular Formula | C8H4BrCl2NS2 |
| Molecular Weight | 329.07 g/mol |
| Exact Mass | 326.83 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2cc(Br)c(Cl)s2)n1 |
| InChI | InChI=1S/C8H4BrCl2NS2/c9-5-1-6(14-7(5)11)8-12-4(2-10)3-13-8/h1,3H,2H2 |
| InChIKey | OQLXIZYSWDTQRC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.07 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|