C8H4Br2ClNS2 — CID 102842143
4-(chloromethyl)-2-(4,5-dibromothiophen-2-yl)-1,3-thiazole (PubChem CID 102842143) has the molecular formula C8H4Br2ClNS2 and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4,5-dibromothiophen-2-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(4,5-dibromothiophen-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 102842143 |
| Molecular Formula | C8H4Br2ClNS2 |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 370.78 |
| IUPAC Name | 4-(chloromethyl)-2-(4,5-dibromothiophen-2-yl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2cc(Br)c(Br)s2)n1 |
| InChI | InChI=1S/C8H4Br2ClNS2/c9-5-1-6(14-7(5)10)8-12-4(2-11)3-13-8/h1,3H,2H2 |
| InChIKey | UHBRFEAOFNQHDT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|