C14H16ClNS — CID 82091892
4-(chloromethyl)-2-(2,3,5,6-tetramethylphenyl)-1,3-thiazole (PubChem CID 82091892) has the molecular formula C14H16ClNS and a molecular weight of 265.81 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2,3,5,6-tetramethylphenyl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(2,3,5,6-tetramethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82091892 |
| Molecular Formula | C14H16ClNS |
| Molecular Weight | 265.81 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-(chloromethyl)-2-(2,3,5,6-tetramethylphenyl)-1,3-thiazole |
| SMILES | Cc1cc(C)c(C)c(-c2nc(CCl)cs2)c1C |
| InChI | InChI=1S/C14H16ClNS/c1-8-5-9(2)11(4)13(10(8)3)14-16-12(6-15)7-17-14/h5,7H,6H2,1-4H3 |
| InChIKey | LGIKZJSBAZZPAD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|