C11H7Cl2NO2S — CID 43143705
2-(7-chloro-1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole (PubChem CID 43143705) has the molecular formula C11H7Cl2NO2S and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 43143705 |
| Molecular Formula | C11H7Cl2NO2S |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2cc(Cl)c3c(c2)OCO3)n1 |
| InChI | InChI=1S/C11H7Cl2NO2S/c12-3-7-4-17-11(14-7)6-1-8(13)10-9(2-6)15-5-16-10/h1-2,4H,3,5H2 |
| InChIKey | NYDLOHYRPWJSAV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|