C8H5BrClN3S — CID 102843847
2-(4-bromo-5-chlorothiophen-2-yl)pyrimidin-4-amine (PubChem CID 102843847) has the molecular formula C8H5BrClN3S and a molecular weight of 290.57 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)pyrimidin-4-amine.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102843847 |
| Molecular Formula | C8H5BrClN3S |
| Molecular Weight | 290.57 g/mol |
| Exact Mass | 288.91 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(-c2cc(Br)c(Cl)s2)n1 |
| InChI | InChI=1S/C8H5BrClN3S/c9-4-3-5(14-7(4)10)8-12-2-1-6(11)13-8/h1-3H,(H2,11,12,13) |
| InChIKey | CVHGKLDTRBTOID-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |