C11H10BrClN4OS — CID 106473662
[2-(4-bromo-5-chlorothiophen-2-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 106473662) has the molecular formula C11H10BrClN4OS and a molecular weight of 361.65 g/mol. Its IUPAC name is [2-(4-bromo-5-chlorothiophen-2-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-bromo-5-chlorothiophen-2-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106473662 |
| Molecular Formula | C11H10BrClN4OS |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | [2-(4-bromo-5-chlorothiophen-2-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2cc(Br)c(Cl)s2)nc2c1COCC2 |
| InChI | InChI=1S/C11H10BrClN4OS/c12-6-3-8(19-9(6)13)11-15-7-1-2-18-4-5(7)10(16-11)17-14/h3H,1-2,4,14H2,(H,15,16,17) |
| InChIKey | INHXFQWYBJTBML-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|