C14H15ClN4O2 — CID 106819770
[2-(4-chloro-2-methoxyphenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 106819770) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxyphenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-chloro-2-methoxyphenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106819770 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [2-(4-chloro-2-methoxyphenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | COc1cc(Cl)ccc1-c1nc2c(c(NN)n1)COCC2 |
| InChI | InChI=1S/C14H15ClN4O2/c1-20-12-6-8(15)2-3-9(12)13-17-11-4-5-21-7-10(11)14(18-13)19-16/h2-3,6H,4-5,7,16H2,1H3,(H,17,18,19) |
| InChIKey | JKWLTLSRTMEQSJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|