C14H16N2O3 — CID 106473119
7,8-dimethoxy-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine (PubChem CID 106473119) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 7,8-dimethoxy-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine.
| Compound Name | 7,8-dimethoxy-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 106473119 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 7,8-dimethoxy-3,4-dihydro-1H-pyrano[4,3-b]quinolin-10-amine |
| SMILES | COc1cc2nc3c(c(N)c2cc1OC)COCC3 |
| InChI | InChI=1S/C14H16N2O3/c1-17-12-5-8-11(6-13(12)18-2)16-10-3-4-19-7-9(10)14(8)15/h5-6H,3-4,7H2,1-2H3,(H2,15,16) |
| InChIKey | CWBJLJBSYZOGTQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |