C13H11Cl2NO2 — CID 107622850
8,10-dichloro-7-methoxy-3,4-dihydro-1H-pyrano[4,3-b]quinoline (PubChem CID 107622850) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 8,10-dichloro-7-methoxy-3,4-dihydro-1H-pyrano[4,3-b]quinoline.
| Compound Name | 8,10-dichloro-7-methoxy-3,4-dihydro-1H-pyrano[4,3-b]quinoline |
|---|---|
| PubChem CID | 107622850 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 8,10-dichloro-7-methoxy-3,4-dihydro-1H-pyrano[4,3-b]quinoline |
| SMILES | COc1cc2nc3c(c(Cl)c2cc1Cl)COCC3 |
| InChI | InChI=1S/C13H11Cl2NO2/c1-17-12-5-11-7(4-9(12)14)13(15)8-6-18-3-2-10(8)16-11/h4-5H,2-3,6H2,1H3 |
| InChIKey | OSTNTWVHZMOYLK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |