C12H10Cl2N4S — CID 83200934
[2-(2,4-dichlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83200934) has the molecular formula C12H10Cl2N4S and a molecular weight of 313.21 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,4-dichlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 83200934 |
| Molecular Formula | C12H10Cl2N4S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(Cl)cc2Cl)nc2c1CSC2 |
| InChI | InChI=1S/C12H10Cl2N4S/c13-6-1-2-7(9(14)3-6)11-16-10-5-19-4-8(10)12(17-11)18-15/h1-3H,4-5,15H2,(H,16,17,18) |
| InChIKey | UHJXKQJBSRDNBH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|