About [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine
[2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83200526) has the molecular formula C10H9BrN4S2
and a molecular weight of 329.25 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| PubChem CID | 83200526 |
| Molecular Formula | C10H9BrN4S2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(Br)s2)nc2c1CSC2 |
| InChI | InChI=1S/C10H9BrN4S2/c11-8-2-1-7(17-8)10-13-6-4-16-3-5(6)9(14-10)15-12/h1-2H,3-4,12H2,(H,13,14,15) |
| InChIKey | RWKVLDJROCDAHE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (CID 83200526) is [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is NNc1nc(-c2ccc(Br)s2)nc2c1CSC2.
What is the InChIKey of [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
The InChIKey is RWKVLDJROCDAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN4S2/c11-8-2-1-7(17-8)10-13-6-4-16-3-5(6)9(14-10)15-12/h1-2H,3-4,12H2,(H,13,14,15).
What are the key properties of [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine?
[2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine has a molecular weight of 329.25 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-bromothiophen-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 83200526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).