C14H12N4S2 — CID 83191648
[2-(1-benzothiophen-3-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83191648) has the molecular formula C14H12N4S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is [2-(1-benzothiophen-3-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1-benzothiophen-3-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 83191648 |
| Molecular Formula | C14H12N4S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [2-(1-benzothiophen-3-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2csc3ccccc23)nc2c1CSC2 |
| InChI | InChI=1S/C14H12N4S2/c15-18-14-10-5-19-7-11(10)16-13(17-14)9-6-20-12-4-2-1-3-8(9)12/h1-4,6H,5,7,15H2,(H,16,17,18) |
| InChIKey | WHAWZTBIVPOOIY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|