C12H11ClN4S — CID 83201592
[2-(4-chlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 83201592) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-chlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 83201592 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | [2-(4-chlorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(Cl)cc2)nc2c1CSC2 |
| InChI | InChI=1S/C12H11ClN4S/c13-8-3-1-7(2-4-8)11-15-10-6-18-5-9(10)12(16-11)17-14/h1-4H,5-6,14H2,(H,15,16,17) |
| InChIKey | ALHQCKKPJJMWRZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|