C10H14ClN3OS — CID 80611871
1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azocan-2-one (PubChem CID 80611871) has the molecular formula C10H14ClN3OS and a molecular weight of 259.76 g/mol. Its IUPAC name is 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azocan-2-one.
| Compound Name | 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azocan-2-one |
|---|---|
| PubChem CID | 80611871 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azocan-2-one |
| SMILES | O=C1CCCCCCN1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C10H14ClN3OS/c11-10-13-12-8(16-10)7-14-6-4-2-1-3-5-9(14)15/h1-7H2 |
| InChIKey | MSBUJCSERCVTTJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |