C20H26N4O2S — CID 47044907
N-[3-(2-oxoazepan-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 47044907) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[3-(2-oxoazepan-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[3-(2-oxoazepan-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 47044907 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-(2-oxoazepan-1-yl)propyl]-2-[2-(pyridin-2-ylmethyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(Cc2ccccn2)n1)NCCCN1CCCCCC1=O |
| InChI | InChI=1S/C20H26N4O2S/c25-18(22-10-6-12-24-11-5-1-2-8-20(24)26)13-17-15-27-19(23-17)14-16-7-3-4-9-21-16/h3-4,7,9,15H,1-2,5-6,8,10-14H2,(H,22,25) |
| InChIKey | XESUJSOCTIQCQG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|