C19H25N3OS — CID 119556470
2-(2-benzyl-1,3-thiazol-4-yl)-N-(2-piperidin-3-ylethyl)acetamide (PubChem CID 119556470) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-(2-piperidin-3-ylethyl)acetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-(2-piperidin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 119556470 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-(2-piperidin-3-ylethyl)acetamide |
| SMILES | O=C(Cc1csc(Cc2ccccc2)n1)NCCC1CCCNC1 |
| InChI | InChI=1S/C19H25N3OS/c23-18(21-10-8-16-7-4-9-20-13-16)12-17-14-24-19(22-17)11-15-5-2-1-3-6-15/h1-3,5-6,14,16,20H,4,7-13H2,(H,21,23) |
| InChIKey | ZRIVWJPMXDPGMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |