C20H26N2OS — CID 38706195
2-(2-benzyl-1,3-thiazol-4-yl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 38706195) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 38706195 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-(2-benzyl-1,3-thiazol-4-yl)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)Cc1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H26N2OS/c1-14-7-6-10-18(15(14)2)22-19(23)12-17-13-24-20(21-17)11-16-8-4-3-5-9-16/h3-5,8-9,13-15,18H,6-7,10-12H2,1-2H3,(H,22,23)/t14-,15-,18-/m1/s1 |
| InChIKey | VZBXUNRMKSPVAT-IIDMSEBBSA-N |
| XLogP | 4.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |