C14H17ClN2S — CID 65029172
N-(1-chloro-3-phenylpropan-2-yl)-4-ethyl-1,3-thiazol-2-amine (PubChem CID 65029172) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is N-(1-chloro-3-phenylpropan-2-yl)-4-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-(1-chloro-3-phenylpropan-2-yl)-4-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65029172 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-(1-chloro-3-phenylpropan-2-yl)-4-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NC(CCl)Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H17ClN2S/c1-2-12-10-18-14(16-12)17-13(9-15)8-11-6-4-3-5-7-11/h3-7,10,13H,2,8-9H2,1H3,(H,16,17) |
| InChIKey | GMAREQQETIZTDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|