C12H15N3S — CID 107648590
N-(1-phenylbutan-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648590) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-(1-phenylbutan-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1-phenylbutan-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648590 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-(1-phenylbutan-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCC(Cc1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C12H15N3S/c1-2-11(14-12-15-13-9-16-12)8-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3,(H,14,15) |
| InChIKey | BHBDILGHWARLGL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |