C10H15N3O3S — CID 103488392
3-[2-(morpholin-4-ylamino)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103488392) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[2-(morpholin-4-ylamino)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(morpholin-4-ylamino)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103488392 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[2-(morpholin-4-ylamino)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(NN2CCOCC2)n1 |
| InChI | InChI=1S/C10H15N3O3S/c14-9(15)2-1-8-7-17-10(11-8)12-13-3-5-16-6-4-13/h7H,1-6H2,(H,11,12)(H,14,15) |
| InChIKey | UZYNPYDDPVMJFS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |