C12H19N3O3S — CID 80575536
2-[2-(3-morpholin-4-ylpropylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80575536) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[2-(3-morpholin-4-ylpropylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3-morpholin-4-ylpropylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80575536 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[2-(3-morpholin-4-ylpropylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C12H19N3O3S/c16-11(17)8-10-9-19-12(14-10)13-2-1-3-15-4-6-18-7-5-15/h9H,1-8H2,(H,13,14)(H,16,17) |
| InChIKey | CFJRHZFMPRROIP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|