C10H16N2S — CID 115691846
4-ethyl-N-[(E)-pent-3-enyl]-1,3-thiazol-2-amine (PubChem CID 115691846) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 4-ethyl-N-[(E)-pent-3-enyl]-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-[(E)-pent-3-enyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115691846 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-ethyl-N-[(E)-pent-3-enyl]-1,3-thiazol-2-amine |
| SMILES | C/C=C/CCNc1nc(CC)cs1 |
| InChI | InChI=1S/C10H16N2S/c1-3-5-6-7-11-10-12-9(4-2)8-13-10/h3,5,8H,4,6-7H2,1-2H3,(H,11,12)/b5-3+ |
| InChIKey | WHGISVAVOSMCEQ-HWKANZROSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|