C10H14N4S — CID 136575144
4-ethyl-N-[2-(1H-pyrazol-5-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 136575144) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 4-ethyl-N-[2-(1H-pyrazol-5-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-[2-(1H-pyrazol-5-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 136575144 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-ethyl-N-[2-(1H-pyrazol-5-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCCc2ccn[nH]2)n1 |
| InChI | InChI=1S/C10H14N4S/c1-2-8-7-15-10(13-8)11-5-3-9-4-6-12-14-9/h4,6-7H,2-3,5H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | IWGUASXUGJJSTJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |