C8H11F2N3O — CID 103081300
N-[2-(2,2-difluoroethoxy)ethyl]pyrimidin-2-amine (PubChem CID 103081300) has the molecular formula C8H11F2N3O and a molecular weight of 203.19 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]pyrimidin-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103081300 |
| Molecular Formula | C8H11F2N3O |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]pyrimidin-2-amine |
| SMILES | FC(F)COCCNc1ncccn1 |
| InChI | InChI=1S/C8H11F2N3O/c9-7(10)6-14-5-4-13-8-11-2-1-3-12-8/h1-3,7H,4-6H2,(H,11,12,13) |
| InChIKey | ISUBKGBEHXWJJX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|