C8H11F2N3O2 — CID 103081364
3-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrazin-2-one (PubChem CID 103081364) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrazin-2-one.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 103081364 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1NCCOCC(F)F |
| InChI | InChI=1S/C8H11F2N3O2/c9-6(10)5-15-4-3-12-7-8(14)13-2-1-11-7/h1-2,6H,3-5H2,(H,11,12)(H,13,14) |
| InChIKey | IWVQGKOADLDONF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|