C10H12F3NO — CID 82010260
N-[2-(2,2-difluoroethoxy)ethyl]-4-fluoroaniline (PubChem CID 82010260) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-fluoroaniline.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 82010260 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-fluoroaniline |
| SMILES | Fc1ccc(NCCOCC(F)F)cc1 |
| InChI | InChI=1S/C10H12F3NO/c11-8-1-3-9(4-2-8)14-5-6-15-7-10(12)13/h1-4,10,14H,5-7H2 |
| InChIKey | UCVZJGRXHITFSW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|