C10H14F2N2O — CID 103081298
N-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyridin-2-amine (PubChem CID 103081298) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyridin-2-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 103081298 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(NCCOCC(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O/c1-8-2-3-13-10(6-8)14-4-5-15-7-9(11)12/h2-3,6,9H,4-5,7H2,1H3,(H,13,14) |
| InChIKey | WSKNIQKALJOLRK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|