C11H20N4O2 — CID 80825947
2-[2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]ethoxy]ethanol (PubChem CID 80825947) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 80825947 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-[2-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]ethoxy]ethanol |
| SMILES | CNc1nc(C)nc(NCCOCCO)c1C |
| InChI | InChI=1S/C11H20N4O2/c1-8-10(12-3)14-9(2)15-11(8)13-4-6-17-7-5-16/h16H,4-7H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | IATUORORMKDWDX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|