C8H13N5O2 — CID 80913506
[4-(cyclopropylmethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80913506) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is [4-(cyclopropylmethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(cyclopropylmethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80913506 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | [4-(cyclopropylmethoxy)-6-methoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(OCC2CC2)n1 |
| InChI | InChI=1S/C8H13N5O2/c1-14-7-10-6(13-9)11-8(12-7)15-4-5-2-3-5/h5H,2-4,9H2,1H3,(H,10,11,12,13) |
| InChIKey | TYIIZBQZEUQIQQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|