C6H7Cl3N4O2 — CID 117061557
4-methoxy-6-(2,2,2-trichloroethoxy)-1,3,5-triazin-2-amine (PubChem CID 117061557) has the molecular formula C6H7Cl3N4O2 and a molecular weight of 273.51 g/mol. Its IUPAC name is 4-methoxy-6-(2,2,2-trichloroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-(2,2,2-trichloroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 117061557 |
| Molecular Formula | C6H7Cl3N4O2 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 4-methoxy-6-(2,2,2-trichloroethoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(OCC(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C6H7Cl3N4O2/c1-14-4-11-3(10)12-5(13-4)15-2-6(7,8)9/h2H2,1H3,(H2,10,11,12,13) |
| InChIKey | YGVJYBPSKNVJRP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|